C15H20F3N — CID 43104879
N-(2,6-dimethylcyclohexyl)-3-(trifluoromethyl)aniline (PubChem CID 43104879) has the molecular formula C15H20F3N and a molecular weight of 271.33 g/mol. Its IUPAC name is N-(2,6-dimethylcyclohexyl)-3-(trifluoromethyl)aniline.
| Compound Name | N-(2,6-dimethylcyclohexyl)-3-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 43104879 |
| Molecular Formula | C15H20F3N |
| Molecular Weight | 271.33 g/mol |
| Exact Mass | 271.15 |
| IUPAC Name | N-(2,6-dimethylcyclohexyl)-3-(trifluoromethyl)aniline |
| SMILES | CC1CCCC(C)C1Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H20F3N/c1-10-5-3-6-11(2)14(10)19-13-8-4-7-12(9-13)15(16,17)18/h4,7-11,14,19H,3,5-6H2,1-2H3 |
| InChIKey | NJKHDPLHBJODBY-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.33 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |