C13H16F3NO2S — CID 65046898
N-(2-methylsulfonylcyclopentyl)-3-(trifluoromethyl)aniline (PubChem CID 65046898) has the molecular formula C13H16F3NO2S and a molecular weight of 307.34 g/mol. Its IUPAC name is N-(2-methylsulfonylcyclopentyl)-3-(trifluoromethyl)aniline.
| Compound Name | N-(2-methylsulfonylcyclopentyl)-3-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 65046898 |
| Molecular Formula | C13H16F3NO2S |
| Molecular Weight | 307.34 g/mol |
| Exact Mass | 307.09 |
| IUPAC Name | N-(2-methylsulfonylcyclopentyl)-3-(trifluoromethyl)aniline |
| SMILES | CS(=O)(=O)C1CCCC1Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H16F3NO2S/c1-20(18,19)12-7-3-6-11(12)17-10-5-2-4-9(8-10)13(14,15)16/h2,4-5,8,11-12,17H,3,6-7H2,1H3 |
| InChIKey | ZYPQUOBEZSAINK-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.34 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |