C12H14F3NO2S — CID 64644682
2-[3-(trifluoromethyl)phenyl]sulfonylcyclopentan-1-amine (PubChem CID 64644682) has the molecular formula C12H14F3NO2S and a molecular weight of 293.31 g/mol. Its IUPAC name is 2-[3-(trifluoromethyl)phenyl]sulfonylcyclopentan-1-amine.
| Compound Name | 2-[3-(trifluoromethyl)phenyl]sulfonylcyclopentan-1-amine |
|---|---|
| PubChem CID | 64644682 |
| Molecular Formula | C12H14F3NO2S |
| Molecular Weight | 293.31 g/mol |
| Exact Mass | 293.07 |
| IUPAC Name | 2-[3-(trifluoromethyl)phenyl]sulfonylcyclopentan-1-amine |
| SMILES | NC1CCCC1S(=O)(=O)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H14F3NO2S/c13-12(14,15)8-3-1-4-9(7-8)19(17,18)11-6-2-5-10(11)16/h1,3-4,7,10-11H,2,5-6,16H2 |
| InChIKey | YKBWGEUXDPOLEJ-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.31 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |