C13H17F3N2O2S — CID 107070709
3-methyl-1-[3-(trifluoromethyl)phenyl]sulfonylpiperidin-2-amine (PubChem CID 107070709) has the molecular formula C13H17F3N2O2S and a molecular weight of 322.35 g/mol. Its IUPAC name is 3-methyl-1-[3-(trifluoromethyl)phenyl]sulfonylpiperidin-2-amine.
| Compound Name | 3-methyl-1-[3-(trifluoromethyl)phenyl]sulfonylpiperidin-2-amine |
|---|---|
| PubChem CID | 107070709 |
| Molecular Formula | C13H17F3N2O2S |
| Molecular Weight | 322.35 g/mol |
| Exact Mass | 322.10 |
| IUPAC Name | 3-methyl-1-[3-(trifluoromethyl)phenyl]sulfonylpiperidin-2-amine |
| SMILES | CC1CCCN(S(=O)(=O)c2cccc(C(F)(F)F)c2)C1N |
| InChI | InChI=1S/C13H17F3N2O2S/c1-9-4-3-7-18(12(9)17)21(19,20)11-6-2-5-10(8-11)13(14,15)16/h2,5-6,8-9,12H,3-4,7,17H2,1H3 |
| InChIKey | SJNBIJIUEATSGB-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.35 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |