C19H20F3NO4S — CID 46823397
2-(2,5-dimethoxyphenyl)-1-[3-(trifluoromethyl)phenyl]sulfonylpyrrolidine (PubChem CID 46823397) has the molecular formula C19H20F3NO4S and a molecular weight of 415.43 g/mol. Its IUPAC name is 2-(2,5-dimethoxyphenyl)-1-[3-(trifluoromethyl)phenyl]sulfonylpyrrolidine.
| Compound Name | 2-(2,5-dimethoxyphenyl)-1-[3-(trifluoromethyl)phenyl]sulfonylpyrrolidine |
|---|---|
| PubChem CID | 46823397 |
| Molecular Formula | C19H20F3NO4S |
| Molecular Weight | 415.43 g/mol |
| Exact Mass | 415.11 |
| IUPAC Name | 2-(2,5-dimethoxyphenyl)-1-[3-(trifluoromethyl)phenyl]sulfonylpyrrolidine |
| SMILES | COc1ccc(OC)c(C2CCCN2S(=O)(=O)c2cccc(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C19H20F3NO4S/c1-26-14-8-9-18(27-2)16(12-14)17-7-4-10-23(17)28(24,25)15-6-3-5-13(11-15)19(20,21)22/h3,5-6,8-9,11-12,17H,4,7,10H2,1-2H3 |
| InChIKey | PMKVLYNSYJBLHC-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.43 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |