C20H23NO6S — CID 55515450
methyl 3-[2-(2,4-dimethoxyphenyl)pyrrolidin-1-yl]sulfonylbenzoate (PubChem CID 55515450) has the molecular formula C20H23NO6S and a molecular weight of 405.47 g/mol. Its IUPAC name is methyl 3-[2-(2,4-dimethoxyphenyl)pyrrolidin-1-yl]sulfonylbenzoate.
| Compound Name | methyl 3-[2-(2,4-dimethoxyphenyl)pyrrolidin-1-yl]sulfonylbenzoate |
|---|---|
| PubChem CID | 55515450 |
| Molecular Formula | C20H23NO6S |
| Molecular Weight | 405.47 g/mol |
| Exact Mass | 405.12 |
| IUPAC Name | methyl 3-[2-(2,4-dimethoxyphenyl)pyrrolidin-1-yl]sulfonylbenzoate |
| SMILES | COC(=O)c1cccc(S(=O)(=O)N2CCCC2c2ccc(OC)cc2OC)c1 |
| InChI | InChI=1S/C20H23NO6S/c1-25-15-9-10-17(19(13-15)26-2)18-8-5-11-21(18)28(23,24)16-7-4-6-14(12-16)20(22)27-3/h4,6-7,9-10,12-13,18H,5,8,11H2,1-3H3 |
| InChIKey | DGRBWATUEOTRAJ-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.47 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |