C19H21NO5S — CID 51320524
methyl 4-[2-(3-methoxyphenyl)pyrrolidin-1-yl]sulfonylbenzoate (PubChem CID 51320524) has the molecular formula C19H21NO5S and a molecular weight of 375.45 g/mol. Its IUPAC name is methyl 4-[2-(3-methoxyphenyl)pyrrolidin-1-yl]sulfonylbenzoate.
| Compound Name | methyl 4-[2-(3-methoxyphenyl)pyrrolidin-1-yl]sulfonylbenzoate |
|---|---|
| PubChem CID | 51320524 |
| Molecular Formula | C19H21NO5S |
| Molecular Weight | 375.45 g/mol |
| Exact Mass | 375.11 |
| IUPAC Name | methyl 4-[2-(3-methoxyphenyl)pyrrolidin-1-yl]sulfonylbenzoate |
| SMILES | COC(=O)c1ccc(S(=O)(=O)N2CCCC2c2cccc(OC)c2)cc1 |
| InChI | InChI=1S/C19H21NO5S/c1-24-16-6-3-5-15(13-16)18-7-4-12-20(18)26(22,23)17-10-8-14(9-11-17)19(21)25-2/h3,5-6,8-11,13,18H,4,7,12H2,1-2H3 |
| InChIKey | GSKVJVSVVYTLFB-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.45 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |