C17H18N2O4S — CID 42943935
methyl 4-(2-pyridin-4-ylpyrrolidin-1-yl)sulfonylbenzoate (PubChem CID 42943935) has the molecular formula C17H18N2O4S and a molecular weight of 346.41 g/mol. Its IUPAC name is methyl 4-(2-pyridin-4-ylpyrrolidin-1-yl)sulfonylbenzoate.
| Compound Name | methyl 4-(2-pyridin-4-ylpyrrolidin-1-yl)sulfonylbenzoate |
|---|---|
| PubChem CID | 42943935 |
| Molecular Formula | C17H18N2O4S |
| Molecular Weight | 346.41 g/mol |
| Exact Mass | 346.10 |
| IUPAC Name | methyl 4-(2-pyridin-4-ylpyrrolidin-1-yl)sulfonylbenzoate |
| SMILES | COC(=O)c1ccc(S(=O)(=O)N2CCCC2c2ccncc2)cc1 |
| InChI | InChI=1S/C17H18N2O4S/c1-23-17(20)14-4-6-15(7-5-14)24(21,22)19-12-2-3-16(19)13-8-10-18-11-9-13/h4-11,16H,2-3,12H2,1H3 |
| InChIKey | SROJFNWQHCSZNG-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 76.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.41 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |