C20H24N2O4S — CID 27304150
4-[(2R)-2-(4-methoxyphenyl)azepan-1-yl]sulfonylbenzamide (PubChem CID 27304150) has the molecular formula C20H24N2O4S and a molecular weight of 388.49 g/mol. Its IUPAC name is 4-[(2R)-2-(4-methoxyphenyl)azepan-1-yl]sulfonylbenzamide.
| Compound Name | 4-[(2R)-2-(4-methoxyphenyl)azepan-1-yl]sulfonylbenzamide |
|---|---|
| PubChem CID | 27304150 |
| Molecular Formula | C20H24N2O4S |
| Molecular Weight | 388.49 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | 4-[(2R)-2-(4-methoxyphenyl)azepan-1-yl]sulfonylbenzamide |
| SMILES | COc1ccc([C@H]2CCCCCN2S(=O)(=O)c2ccc(C(N)=O)cc2)cc1 |
| InChI | InChI=1S/C20H24N2O4S/c1-26-17-10-6-15(7-11-17)19-5-3-2-4-14-22(19)27(24,25)18-12-8-16(9-13-18)20(21)23/h6-13,19H,2-5,14H2,1H3,(H2,21,23)/t19-/m1/s1 |
| InChIKey | FRLYVLLDHSSYOW-LJQANCHMSA-N |
| XLogP | 3.10 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.49 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |