C19H22FNO3S — CID 53096130
2-(3-fluorophenyl)-1-(4-methoxyphenyl)sulfonylazepane (PubChem CID 53096130) has the molecular formula C19H22FNO3S and a molecular weight of 363.45 g/mol. Its IUPAC name is 2-(3-fluorophenyl)-1-(4-methoxyphenyl)sulfonylazepane.
| Compound Name | 2-(3-fluorophenyl)-1-(4-methoxyphenyl)sulfonylazepane |
|---|---|
| PubChem CID | 53096130 |
| Molecular Formula | C19H22FNO3S |
| Molecular Weight | 363.45 g/mol |
| Exact Mass | 363.13 |
| IUPAC Name | 2-(3-fluorophenyl)-1-(4-methoxyphenyl)sulfonylazepane |
| SMILES | COc1ccc(S(=O)(=O)N2CCCCCC2c2cccc(F)c2)cc1 |
| InChI | InChI=1S/C19H22FNO3S/c1-24-17-9-11-18(12-10-17)25(22,23)21-13-4-2-3-8-19(21)15-6-5-7-16(20)14-15/h5-7,9-12,14,19H,2-4,8,13H2,1H3 |
| InChIKey | NGXFMHKBHLOOKH-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.45 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |