C17H18FNO3S — CID 51320506
1-(3-fluorophenyl)sulfonyl-2-(3-methoxyphenyl)pyrrolidine (PubChem CID 51320506) has the molecular formula C17H18FNO3S and a molecular weight of 335.40 g/mol. Its IUPAC name is 1-(3-fluorophenyl)sulfonyl-2-(3-methoxyphenyl)pyrrolidine.
| Compound Name | 1-(3-fluorophenyl)sulfonyl-2-(3-methoxyphenyl)pyrrolidine |
|---|---|
| PubChem CID | 51320506 |
| Molecular Formula | C17H18FNO3S |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.10 |
| IUPAC Name | 1-(3-fluorophenyl)sulfonyl-2-(3-methoxyphenyl)pyrrolidine |
| SMILES | COc1cccc(C2CCCN2S(=O)(=O)c2cccc(F)c2)c1 |
| InChI | InChI=1S/C17H18FNO3S/c1-22-15-7-2-5-13(11-15)17-9-4-10-19(17)23(20,21)16-8-3-6-14(18)12-16/h2-3,5-8,11-12,17H,4,9-10H2,1H3 |
| InChIKey | GITCJPCFENLNRD-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |