C14H17N3O3S — CID 60960045
4-[2-(3-methoxyphenyl)pyrrolidin-1-yl]sulfonyl-1H-pyrazole (PubChem CID 60960045) has the molecular formula C14H17N3O3S and a molecular weight of 307.38 g/mol. Its IUPAC name is 4-[2-(3-methoxyphenyl)pyrrolidin-1-yl]sulfonyl-1H-pyrazole.
| Compound Name | 4-[2-(3-methoxyphenyl)pyrrolidin-1-yl]sulfonyl-1H-pyrazole |
|---|---|
| PubChem CID | 60960045 |
| Molecular Formula | C14H17N3O3S |
| Molecular Weight | 307.38 g/mol |
| Exact Mass | 307.10 |
| IUPAC Name | 4-[2-(3-methoxyphenyl)pyrrolidin-1-yl]sulfonyl-1H-pyrazole |
| SMILES | COc1cccc(C2CCCN2S(=O)(=O)c2cn[nH]c2)c1 |
| InChI | InChI=1S/C14H17N3O3S/c1-20-12-5-2-4-11(8-12)14-6-3-7-17(14)21(18,19)13-9-15-16-10-13/h2,4-5,8-10,14H,3,6-7H2,1H3,(H,15,16) |
| InChIKey | KJYHYJZGCTYANZ-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 75.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.38 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |