C18H19FN2O4S — CID 95078984
(2S)-2-(3-fluorophenyl)-1-(4-nitrophenyl)sulfonylazepane (PubChem CID 95078984) has the molecular formula C18H19FN2O4S and a molecular weight of 378.43 g/mol. Its IUPAC name is (2S)-2-(3-fluorophenyl)-1-(4-nitrophenyl)sulfonylazepane.
| Compound Name | (2S)-2-(3-fluorophenyl)-1-(4-nitrophenyl)sulfonylazepane |
|---|---|
| PubChem CID | 95078984 |
| Molecular Formula | C18H19FN2O4S |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.10 |
| IUPAC Name | (2S)-2-(3-fluorophenyl)-1-(4-nitrophenyl)sulfonylazepane |
| SMILES | O=[N+]([O-])c1ccc(S(=O)(=O)N2CCCCC[C@H]2c2cccc(F)c2)cc1 |
| InChI | InChI=1S/C18H19FN2O4S/c19-15-6-4-5-14(13-15)18-7-2-1-3-12-20(18)26(24,25)17-10-8-16(9-11-17)21(22)23/h4-6,8-11,13,18H,1-3,7,12H2/t18-/m0/s1 |
| InChIKey | NZMSGALJDCOHBK-SFHVURJKSA-N |
| XLogP | 4.04 |
| TPSA | 80.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|