C18H19BrFNO2S — CID 68846672
2-[3-(bromomethyl)phenyl]-1-(4-fluorophenyl)sulfonylpiperidine (PubChem CID 68846672) has the molecular formula C18H19BrFNO2S and a molecular weight of 412.32 g/mol. Its IUPAC name is 2-[3-(bromomethyl)phenyl]-1-(4-fluorophenyl)sulfonylpiperidine.
| Compound Name | 2-[3-(bromomethyl)phenyl]-1-(4-fluorophenyl)sulfonylpiperidine |
|---|---|
| PubChem CID | 68846672 |
| Molecular Formula | C18H19BrFNO2S |
| Molecular Weight | 412.32 g/mol |
| Exact Mass | 411.03 |
| IUPAC Name | 2-[3-(bromomethyl)phenyl]-1-(4-fluorophenyl)sulfonylpiperidine |
| SMILES | O=S(=O)(c1ccc(F)cc1)N1CCCCC1c1cccc(CBr)c1 |
| InChI | InChI=1S/C18H19BrFNO2S/c19-13-14-4-3-5-15(12-14)18-6-1-2-11-21(18)24(22,23)17-9-7-16(20)8-10-17/h3-5,7-10,12,18H,1-2,6,11,13H2 |
| InChIKey | WFEWZBGXHVCXPR-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.32 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|