C22H21FN2O2S — CID 110254506
2-benzyl-6-[1-(4-fluorophenyl)sulfonylpyrrolidin-2-yl]pyridine (PubChem CID 110254506) has the molecular formula C22H21FN2O2S and a molecular weight of 396.49 g/mol. Its IUPAC name is 2-benzyl-6-[1-(4-fluorophenyl)sulfonylpyrrolidin-2-yl]pyridine.
| Compound Name | 2-benzyl-6-[1-(4-fluorophenyl)sulfonylpyrrolidin-2-yl]pyridine |
|---|---|
| PubChem CID | 110254506 |
| Molecular Formula | C22H21FN2O2S |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.13 |
| IUPAC Name | 2-benzyl-6-[1-(4-fluorophenyl)sulfonylpyrrolidin-2-yl]pyridine |
| SMILES | O=S(=O)(c1ccc(F)cc1)N1CCCC1c1cccc(Cc2ccccc2)n1 |
| InChI | InChI=1S/C22H21FN2O2S/c23-18-11-13-20(14-12-18)28(26,27)25-15-5-10-22(25)21-9-4-8-19(24-21)16-17-6-2-1-3-7-17/h1-4,6-9,11-14,22H,5,10,15-16H2 |
| InChIKey | WGOPEVGEYBTJOW-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |