C22H26N2O — CID 95818235
[(2R)-2-(6-benzyl-2-pyridinyl)pyrrolidin-1-yl]-cyclopentylmethanone (PubChem CID 95818235) has the molecular formula C22H26N2O and a molecular weight of 334.46 g/mol. Its IUPAC name is [(2R)-2-(6-benzyl-2-pyridinyl)pyrrolidin-1-yl]-cyclopentylmethanone.
| Compound Name | [(2R)-2-(6-benzyl-2-pyridinyl)pyrrolidin-1-yl]-cyclopentylmethanone |
|---|---|
| PubChem CID | 95818235 |
| Molecular Formula | C22H26N2O |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.20 |
| IUPAC Name | [(2R)-2-(6-benzyl-2-pyridinyl)pyrrolidin-1-yl]-cyclopentylmethanone |
| SMILES | O=C(C1CCCC1)N1CCC[C@@H]1c1cccc(Cc2ccccc2)n1 |
| InChI | InChI=1S/C22H26N2O/c25-22(18-10-4-5-11-18)24-15-7-14-21(24)20-13-6-12-19(23-20)16-17-8-2-1-3-9-17/h1-3,6,8-9,12-13,18,21H,4-5,7,10-11,14-16H2/t21-/m1/s1 |
| InChIKey | CLAJVGIYTZFUAO-OAQYLSRUSA-N |
| XLogP | 4.53 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |