C22H26N2O — CID 110249571
[3-(6-benzyl-2-pyridinyl)piperidin-1-yl]-cyclobutylmethanone (PubChem CID 110249571) has the molecular formula C22H26N2O and a molecular weight of 334.46 g/mol. Its IUPAC name is [3-(6-benzyl-2-pyridinyl)piperidin-1-yl]-cyclobutylmethanone.
| Compound Name | [3-(6-benzyl-2-pyridinyl)piperidin-1-yl]-cyclobutylmethanone |
|---|---|
| PubChem CID | 110249571 |
| Molecular Formula | C22H26N2O |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.20 |
| IUPAC Name | [3-(6-benzyl-2-pyridinyl)piperidin-1-yl]-cyclobutylmethanone |
| SMILES | O=C(C1CCC1)N1CCCC(c2cccc(Cc3ccccc3)n2)C1 |
| InChI | InChI=1S/C22H26N2O/c25-22(18-9-4-10-18)24-14-6-11-19(16-24)21-13-5-12-20(23-21)15-17-7-2-1-3-8-17/h1-3,5,7-8,12-13,18-19H,4,6,9-11,14-16H2 |
| InChIKey | KVVISLVRZWUPPK-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |