C26H27FN2O — CID 110249457
1-[3-[6-[(3-fluorophenyl)methyl]-2-pyridinyl]piperidin-1-yl]-3-phenylpropan-1-one (PubChem CID 110249457) has the molecular formula C26H27FN2O and a molecular weight of 402.51 g/mol. Its IUPAC name is 1-[3-[6-[(3-fluorophenyl)methyl]-2-pyridinyl]piperidin-1-yl]-3-phenylpropan-1-one.
| Compound Name | 1-[3-[6-[(3-fluorophenyl)methyl]-2-pyridinyl]piperidin-1-yl]-3-phenylpropan-1-one |
|---|---|
| PubChem CID | 110249457 |
| Molecular Formula | C26H27FN2O |
| Molecular Weight | 402.51 g/mol |
| Exact Mass | 402.21 |
| IUPAC Name | 1-[3-[6-[(3-fluorophenyl)methyl]-2-pyridinyl]piperidin-1-yl]-3-phenylpropan-1-one |
| SMILES | O=C(CCc1ccccc1)N1CCCC(c2cccc(Cc3cccc(F)c3)n2)C1 |
| InChI | InChI=1S/C26H27FN2O/c27-23-11-4-9-21(17-23)18-24-12-5-13-25(28-24)22-10-6-16-29(19-22)26(30)15-14-20-7-2-1-3-8-20/h1-5,7-9,11-13,17,22H,6,10,14-16,18-19H2 |
| InChIKey | GBJKGESVPDCPLV-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.51 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |