C25H25FN2O — CID 95809016
(4-fluorophenyl)-[(3S)-3-[6-[(3-methylphenyl)methyl]-2-pyridinyl]piperidin-1-yl]methanone (PubChem CID 95809016) has the molecular formula C25H25FN2O and a molecular weight of 388.49 g/mol. Its IUPAC name is (4-fluorophenyl)-[(3S)-3-[6-[(3-methylphenyl)methyl]-2-pyridinyl]piperidin-1-yl]methanone.
| Compound Name | (4-fluorophenyl)-[(3S)-3-[6-[(3-methylphenyl)methyl]-2-pyridinyl]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 95809016 |
| Molecular Formula | C25H25FN2O |
| Molecular Weight | 388.49 g/mol |
| Exact Mass | 388.20 |
| IUPAC Name | (4-fluorophenyl)-[(3S)-3-[6-[(3-methylphenyl)methyl]-2-pyridinyl]piperidin-1-yl]methanone |
| SMILES | Cc1cccc(Cc2cccc([C@H]3CCCN(C(=O)c4ccc(F)cc4)C3)n2)c1 |
| InChI | InChI=1S/C25H25FN2O/c1-18-5-2-6-19(15-18)16-23-8-3-9-24(27-23)21-7-4-14-28(17-21)25(29)20-10-12-22(26)13-11-20/h2-3,5-6,8-13,15,21H,4,7,14,16-17H2,1H3/t21-/m0/s1 |
| InChIKey | LRTLNXVRBISFEQ-NRFANRHFSA-N |
| XLogP | 5.14 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.49 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |