C24H30FN3O — CID 110249321
2-[3-[6-[(3-fluorophenyl)methyl]-2-pyridinyl]piperidin-1-yl]-1-piperidin-1-ylethanone (PubChem CID 110249321) has the molecular formula C24H30FN3O and a molecular weight of 395.52 g/mol. Its IUPAC name is 2-[3-[6-[(3-fluorophenyl)methyl]-2-pyridinyl]piperidin-1-yl]-1-piperidin-1-ylethanone.
| Compound Name | 2-[3-[6-[(3-fluorophenyl)methyl]-2-pyridinyl]piperidin-1-yl]-1-piperidin-1-ylethanone |
|---|---|
| PubChem CID | 110249321 |
| Molecular Formula | C24H30FN3O |
| Molecular Weight | 395.52 g/mol |
| Exact Mass | 395.24 |
| IUPAC Name | 2-[3-[6-[(3-fluorophenyl)methyl]-2-pyridinyl]piperidin-1-yl]-1-piperidin-1-ylethanone |
| SMILES | O=C(CN1CCCC(c2cccc(Cc3cccc(F)c3)n2)C1)N1CCCCC1 |
| InChI | InChI=1S/C24H30FN3O/c25-21-9-4-7-19(15-21)16-22-10-5-11-23(26-22)20-8-6-12-27(17-20)18-24(29)28-13-2-1-3-14-28/h4-5,7,9-11,15,20H,1-3,6,8,12-14,16-18H2 |
| InChIKey | WJEMDLQZBWQCRM-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.52 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |