C23H28FN3O — CID 110249315
2-[3-[6-(2-fluorophenyl)-2-pyridinyl]piperidin-1-yl]-1-piperidin-1-ylethanone (PubChem CID 110249315) has the molecular formula C23H28FN3O and a molecular weight of 381.50 g/mol. Its IUPAC name is 2-[3-[6-(2-fluorophenyl)-2-pyridinyl]piperidin-1-yl]-1-piperidin-1-ylethanone.
| Compound Name | 2-[3-[6-(2-fluorophenyl)-2-pyridinyl]piperidin-1-yl]-1-piperidin-1-ylethanone |
|---|---|
| PubChem CID | 110249315 |
| Molecular Formula | C23H28FN3O |
| Molecular Weight | 381.50 g/mol |
| Exact Mass | 381.22 |
| IUPAC Name | 2-[3-[6-(2-fluorophenyl)-2-pyridinyl]piperidin-1-yl]-1-piperidin-1-ylethanone |
| SMILES | O=C(CN1CCCC(c2cccc(-c3ccccc3F)n2)C1)N1CCCCC1 |
| InChI | InChI=1S/C23H28FN3O/c24-20-10-3-2-9-19(20)22-12-6-11-21(25-22)18-8-7-13-26(16-18)17-23(28)27-14-4-1-5-15-27/h2-3,6,9-12,18H,1,4-5,7-8,13-17H2 |
| InChIKey | IAKWGUVSKLOYSJ-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.50 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |