C22H22FN3 — CID 95809144
2-(2-fluorophenyl)-6-[(3R)-1-(pyridin-4-ylmethyl)piperidin-3-yl]pyridine (PubChem CID 95809144) has the molecular formula C22H22FN3 and a molecular weight of 347.44 g/mol. Its IUPAC name is 2-(2-fluorophenyl)-6-[(3R)-1-(pyridin-4-ylmethyl)piperidin-3-yl]pyridine.
| Compound Name | 2-(2-fluorophenyl)-6-[(3R)-1-(pyridin-4-ylmethyl)piperidin-3-yl]pyridine |
|---|---|
| PubChem CID | 95809144 |
| Molecular Formula | C22H22FN3 |
| Molecular Weight | 347.44 g/mol |
| Exact Mass | 347.18 |
| IUPAC Name | 2-(2-fluorophenyl)-6-[(3R)-1-(pyridin-4-ylmethyl)piperidin-3-yl]pyridine |
| SMILES | Fc1ccccc1-c1cccc([C@@H]2CCCN(Cc3ccncc3)C2)n1 |
| InChI | InChI=1S/C22H22FN3/c23-20-7-2-1-6-19(20)22-9-3-8-21(25-22)18-5-4-14-26(16-18)15-17-10-12-24-13-11-17/h1-3,6-13,18H,4-5,14-16H2/t18-/m1/s1 |
| InChIKey | SEDZGKUARVGQTB-GOSISDBHSA-N |
| XLogP | 4.66 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.44 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |