C23H25N3 — CID 95809141
2-(3-methylphenyl)-6-[(3S)-1-(pyridin-4-ylmethyl)piperidin-3-yl]pyridine (PubChem CID 95809141) has the molecular formula C23H25N3 and a molecular weight of 343.47 g/mol. Its IUPAC name is 2-(3-methylphenyl)-6-[(3S)-1-(pyridin-4-ylmethyl)piperidin-3-yl]pyridine.
| Compound Name | 2-(3-methylphenyl)-6-[(3S)-1-(pyridin-4-ylmethyl)piperidin-3-yl]pyridine |
|---|---|
| PubChem CID | 95809141 |
| Molecular Formula | C23H25N3 |
| Molecular Weight | 343.47 g/mol |
| Exact Mass | 343.20 |
| IUPAC Name | 2-(3-methylphenyl)-6-[(3S)-1-(pyridin-4-ylmethyl)piperidin-3-yl]pyridine |
| SMILES | Cc1cccc(-c2cccc([C@H]3CCCN(Cc4ccncc4)C3)n2)c1 |
| InChI | InChI=1S/C23H25N3/c1-18-5-2-6-20(15-18)22-8-3-9-23(25-22)21-7-4-14-26(17-21)16-19-10-12-24-13-11-19/h2-3,5-6,8-13,15,21H,4,7,14,16-17H2,1H3/t21-/m0/s1 |
| InChIKey | GYUNEUBTDDNWIM-NRFANRHFSA-N |
| XLogP | 4.83 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.47 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |