C24H28N4 — CID 95810588
2-ethyl-5-[[(3R)-3-[6-(3-methylphenyl)-2-pyridinyl]piperidin-1-yl]methyl]pyrimidine (PubChem CID 95810588) has the molecular formula C24H28N4 and a molecular weight of 372.52 g/mol. Its IUPAC name is 2-ethyl-5-[[(3R)-3-[6-(3-methylphenyl)-2-pyridinyl]piperidin-1-yl]methyl]pyrimidine.
| Compound Name | 2-ethyl-5-[[(3R)-3-[6-(3-methylphenyl)-2-pyridinyl]piperidin-1-yl]methyl]pyrimidine |
|---|---|
| PubChem CID | 95810588 |
| Molecular Formula | C24H28N4 |
| Molecular Weight | 372.52 g/mol |
| Exact Mass | 372.23 |
| IUPAC Name | 2-ethyl-5-[[(3R)-3-[6-(3-methylphenyl)-2-pyridinyl]piperidin-1-yl]methyl]pyrimidine |
| SMILES | CCc1ncc(CN2CCC[C@@H](c3cccc(-c4cccc(C)c4)n3)C2)cn1 |
| InChI | InChI=1S/C24H28N4/c1-3-24-25-14-19(15-26-24)16-28-12-6-9-21(17-28)23-11-5-10-22(27-23)20-8-4-7-18(2)13-20/h4-5,7-8,10-11,13-15,21H,3,6,9,12,16-17H2,1-2H3/t21-/m1/s1 |
| InChIKey | BTVVVSKNMTUODX-OAQYLSRUSA-N |
| XLogP | 4.79 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.52 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |