C23H28N4 — CID 95810615
2-[(3S)-1-[(1-ethylimidazol-2-yl)methyl]piperidin-3-yl]-6-(3-methylphenyl)pyridine (PubChem CID 95810615) has the molecular formula C23H28N4 and a molecular weight of 360.51 g/mol. Its IUPAC name is 2-[(3S)-1-[(1-ethylimidazol-2-yl)methyl]piperidin-3-yl]-6-(3-methylphenyl)pyridine.
| Compound Name | 2-[(3S)-1-[(1-ethylimidazol-2-yl)methyl]piperidin-3-yl]-6-(3-methylphenyl)pyridine |
|---|---|
| PubChem CID | 95810615 |
| Molecular Formula | C23H28N4 |
| Molecular Weight | 360.51 g/mol |
| Exact Mass | 360.23 |
| IUPAC Name | 2-[(3S)-1-[(1-ethylimidazol-2-yl)methyl]piperidin-3-yl]-6-(3-methylphenyl)pyridine |
| SMILES | CCn1ccnc1CN1CCC[C@H](c2cccc(-c3cccc(C)c3)n2)C1 |
| InChI | InChI=1S/C23H28N4/c1-3-27-14-12-24-23(27)17-26-13-6-9-20(16-26)22-11-5-10-21(25-22)19-8-4-7-18(2)15-19/h4-5,7-8,10-12,14-15,20H,3,6,9,13,16-17H2,1-2H3/t20-/m0/s1 |
| InChIKey | DHVLRAOLWHQFCX-FQEVSTJZSA-N |
| XLogP | 4.65 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.51 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |