C22H27N5 — CID 95819373
2-[(3S)-1-[(1-ethylimidazol-2-yl)methyl]piperidin-3-yl]-3-(3-methylphenyl)pyrazine (PubChem CID 95819373) has the molecular formula C22H27N5 and a molecular weight of 361.49 g/mol. Its IUPAC name is 2-[(3S)-1-[(1-ethylimidazol-2-yl)methyl]piperidin-3-yl]-3-(3-methylphenyl)pyrazine.
| Compound Name | 2-[(3S)-1-[(1-ethylimidazol-2-yl)methyl]piperidin-3-yl]-3-(3-methylphenyl)pyrazine |
|---|---|
| PubChem CID | 95819373 |
| Molecular Formula | C22H27N5 |
| Molecular Weight | 361.49 g/mol |
| Exact Mass | 361.23 |
| IUPAC Name | 2-[(3S)-1-[(1-ethylimidazol-2-yl)methyl]piperidin-3-yl]-3-(3-methylphenyl)pyrazine |
| SMILES | CCn1ccnc1CN1CCC[C@H](c2nccnc2-c2cccc(C)c2)C1 |
| InChI | InChI=1S/C22H27N5/c1-3-27-13-11-23-20(27)16-26-12-5-8-19(15-26)22-21(24-9-10-25-22)18-7-4-6-17(2)14-18/h4,6-7,9-11,13-14,19H,3,5,8,12,15-16H2,1-2H3/t19-/m0/s1 |
| InChIKey | URPQEGSUVFZHJT-IBGZPJMESA-N |
| XLogP | 4.05 |
| TPSA | 46.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.49 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |