C22H28N4O2 — CID 95819217
1-[(3R)-3-[3-(3-methylphenyl)pyrazin-2-yl]piperidin-1-yl]-2-morpholin-4-ylethanone (PubChem CID 95819217) has the molecular formula C22H28N4O2 and a molecular weight of 380.49 g/mol. Its IUPAC name is 1-[(3R)-3-[3-(3-methylphenyl)pyrazin-2-yl]piperidin-1-yl]-2-morpholin-4-ylethanone.
| Compound Name | 1-[(3R)-3-[3-(3-methylphenyl)pyrazin-2-yl]piperidin-1-yl]-2-morpholin-4-ylethanone |
|---|---|
| PubChem CID | 95819217 |
| Molecular Formula | C22H28N4O2 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.22 |
| IUPAC Name | 1-[(3R)-3-[3-(3-methylphenyl)pyrazin-2-yl]piperidin-1-yl]-2-morpholin-4-ylethanone |
| SMILES | Cc1cccc(-c2nccnc2[C@@H]2CCCN(C(=O)CN3CCOCC3)C2)c1 |
| InChI | InChI=1S/C22H28N4O2/c1-17-4-2-5-18(14-17)21-22(24-8-7-23-21)19-6-3-9-26(15-19)20(27)16-25-10-12-28-13-11-25/h2,4-5,7-8,14,19H,3,6,9-13,15-16H2,1H3/t19-/m1/s1 |
| InChIKey | XJRVYYLTCKKGSB-LJQANCHMSA-N |
| XLogP | 2.49 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |