C23H29N3O2 — CID 95809060
2-[(3R)-3-[6-(3-methylphenyl)-2-pyridinyl]piperidin-1-yl]-1-morpholin-4-ylethanone (PubChem CID 95809060) has the molecular formula C23H29N3O2 and a molecular weight of 379.50 g/mol. Its IUPAC name is 2-[(3R)-3-[6-(3-methylphenyl)-2-pyridinyl]piperidin-1-yl]-1-morpholin-4-ylethanone.
| Compound Name | 2-[(3R)-3-[6-(3-methylphenyl)-2-pyridinyl]piperidin-1-yl]-1-morpholin-4-ylethanone |
|---|---|
| PubChem CID | 95809060 |
| Molecular Formula | C23H29N3O2 |
| Molecular Weight | 379.50 g/mol |
| Exact Mass | 379.23 |
| IUPAC Name | 2-[(3R)-3-[6-(3-methylphenyl)-2-pyridinyl]piperidin-1-yl]-1-morpholin-4-ylethanone |
| SMILES | Cc1cccc(-c2cccc([C@@H]3CCCN(CC(=O)N4CCOCC4)C3)n2)c1 |
| InChI | InChI=1S/C23H29N3O2/c1-18-5-2-6-19(15-18)21-8-3-9-22(24-21)20-7-4-10-25(16-20)17-23(27)26-11-13-28-14-12-26/h2-3,5-6,8-9,15,20H,4,7,10-14,16-17H2,1H3/t20-/m1/s1 |
| InChIKey | MKMIBYXVIPMDRX-HXUWFJFHSA-N |
| XLogP | 3.10 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.50 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |