C22H26FN3O2 — CID 95809063
2-[(3S)-3-[6-(4-fluorophenyl)-2-pyridinyl]piperidin-1-yl]-1-morpholin-4-ylethanone (PubChem CID 95809063) has the molecular formula C22H26FN3O2 and a molecular weight of 383.47 g/mol. Its IUPAC name is 2-[(3S)-3-[6-(4-fluorophenyl)-2-pyridinyl]piperidin-1-yl]-1-morpholin-4-ylethanone.
| Compound Name | 2-[(3S)-3-[6-(4-fluorophenyl)-2-pyridinyl]piperidin-1-yl]-1-morpholin-4-ylethanone |
|---|---|
| PubChem CID | 95809063 |
| Molecular Formula | C22H26FN3O2 |
| Molecular Weight | 383.47 g/mol |
| Exact Mass | 383.20 |
| IUPAC Name | 2-[(3S)-3-[6-(4-fluorophenyl)-2-pyridinyl]piperidin-1-yl]-1-morpholin-4-ylethanone |
| SMILES | O=C(CN1CCC[C@H](c2cccc(-c3ccc(F)cc3)n2)C1)N1CCOCC1 |
| InChI | InChI=1S/C22H26FN3O2/c23-19-8-6-17(7-9-19)20-4-1-5-21(24-20)18-3-2-10-25(15-18)16-22(27)26-11-13-28-14-12-26/h1,4-9,18H,2-3,10-16H2/t18-/m0/s1 |
| InChIKey | JUUVNQJIKAWEMO-SFHVURJKSA-N |
| XLogP | 2.93 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.47 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |