C23H20F2N2O — CID 110249296
(4-fluorophenyl)-[3-[6-(4-fluorophenyl)-2-pyridinyl]piperidin-1-yl]methanone (PubChem CID 110249296) has the molecular formula C23H20F2N2O and a molecular weight of 378.42 g/mol. Its IUPAC name is (4-fluorophenyl)-[3-[6-(4-fluorophenyl)-2-pyridinyl]piperidin-1-yl]methanone.
| Compound Name | (4-fluorophenyl)-[3-[6-(4-fluorophenyl)-2-pyridinyl]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 110249296 |
| Molecular Formula | C23H20F2N2O |
| Molecular Weight | 378.42 g/mol |
| Exact Mass | 378.15 |
| IUPAC Name | (4-fluorophenyl)-[3-[6-(4-fluorophenyl)-2-pyridinyl]piperidin-1-yl]methanone |
| SMILES | O=C(c1ccc(F)cc1)N1CCCC(c2cccc(-c3ccc(F)cc3)n2)C1 |
| InChI | InChI=1S/C23H20F2N2O/c24-19-10-6-16(7-11-19)21-4-1-5-22(26-21)18-3-2-14-27(15-18)23(28)17-8-12-20(25)13-9-17/h1,4-13,18H,2-3,14-15H2 |
| InChIKey | HDGJZRHYMGDYRZ-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.42 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |