C24H24N2O — CID 95808945
[(3R)-3-[6-(3-methylphenyl)-2-pyridinyl]piperidin-1-yl]-phenylmethanone (PubChem CID 95808945) has the molecular formula C24H24N2O and a molecular weight of 356.47 g/mol. Its IUPAC name is [(3R)-3-[6-(3-methylphenyl)-2-pyridinyl]piperidin-1-yl]-phenylmethanone.
| Compound Name | [(3R)-3-[6-(3-methylphenyl)-2-pyridinyl]piperidin-1-yl]-phenylmethanone |
|---|---|
| PubChem CID | 95808945 |
| Molecular Formula | C24H24N2O |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.19 |
| IUPAC Name | [(3R)-3-[6-(3-methylphenyl)-2-pyridinyl]piperidin-1-yl]-phenylmethanone |
| SMILES | Cc1cccc(-c2cccc([C@@H]3CCCN(C(=O)c4ccccc4)C3)n2)c1 |
| InChI | InChI=1S/C24H24N2O/c1-18-8-5-11-20(16-18)22-13-6-14-23(25-22)21-12-7-15-26(17-21)24(27)19-9-3-2-4-10-19/h2-6,8-11,13-14,16,21H,7,12,15,17H2,1H3/t21-/m1/s1 |
| InChIKey | MATHOWLCAFMVTE-OAQYLSRUSA-N |
| XLogP | 5.08 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |