C26H24N2O2 — CID 110089978
(2-methyl-1-benzofuran-5-yl)-[3-(6-phenyl-2-pyridinyl)piperidin-1-yl]methanone (PubChem CID 110089978) has the molecular formula C26H24N2O2 and a molecular weight of 396.49 g/mol. Its IUPAC name is (2-methyl-1-benzofuran-5-yl)-[3-(6-phenyl-2-pyridinyl)piperidin-1-yl]methanone.
| Compound Name | (2-methyl-1-benzofuran-5-yl)-[3-(6-phenyl-2-pyridinyl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 110089978 |
| Molecular Formula | C26H24N2O2 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.18 |
| IUPAC Name | (2-methyl-1-benzofuran-5-yl)-[3-(6-phenyl-2-pyridinyl)piperidin-1-yl]methanone |
| SMILES | Cc1cc2cc(C(=O)N3CCCC(c4cccc(-c5ccccc5)n4)C3)ccc2o1 |
| InChI | InChI=1S/C26H24N2O2/c1-18-15-22-16-20(12-13-25(22)30-18)26(29)28-14-6-9-21(17-28)24-11-5-10-23(27-24)19-7-3-2-4-8-19/h2-5,7-8,10-13,15-16,21H,6,9,14,17H2,1H3 |
| InChIKey | MOTJLDLRMZTGLU-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |