C24H24N2O2 — CID 95808958
[(3S)-3-[6-(4-methoxyphenyl)-2-pyridinyl]piperidin-1-yl]-phenylmethanone (PubChem CID 95808958) has the molecular formula C24H24N2O2 and a molecular weight of 372.47 g/mol. Its IUPAC name is [(3S)-3-[6-(4-methoxyphenyl)-2-pyridinyl]piperidin-1-yl]-phenylmethanone.
| Compound Name | [(3S)-3-[6-(4-methoxyphenyl)-2-pyridinyl]piperidin-1-yl]-phenylmethanone |
|---|---|
| PubChem CID | 95808958 |
| Molecular Formula | C24H24N2O2 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.18 |
| IUPAC Name | [(3S)-3-[6-(4-methoxyphenyl)-2-pyridinyl]piperidin-1-yl]-phenylmethanone |
| SMILES | COc1ccc(-c2cccc([C@H]3CCCN(C(=O)c4ccccc4)C3)n2)cc1 |
| InChI | InChI=1S/C24H24N2O2/c1-28-21-14-12-18(13-15-21)22-10-5-11-23(25-22)20-9-6-16-26(17-20)24(27)19-7-3-2-4-8-19/h2-5,7-8,10-15,20H,6,9,16-17H2,1H3/t20-/m0/s1 |
| InChIKey | XVMFMWQWUULZNI-FQEVSTJZSA-N |
| XLogP | 4.78 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |