C29H32N2O2 — CID 110149301
[3-[6-(3-methylphenyl)-2-pyridinyl]piperidin-1-yl]-(4-phenyloxan-4-yl)methanone (PubChem CID 110149301) has the molecular formula C29H32N2O2 and a molecular weight of 440.59 g/mol. Its IUPAC name is [3-[6-(3-methylphenyl)-2-pyridinyl]piperidin-1-yl]-(4-phenyloxan-4-yl)methanone.
| Compound Name | [3-[6-(3-methylphenyl)-2-pyridinyl]piperidin-1-yl]-(4-phenyloxan-4-yl)methanone |
|---|---|
| PubChem CID | 110149301 |
| Molecular Formula | C29H32N2O2 |
| Molecular Weight | 440.59 g/mol |
| Exact Mass | 440.25 |
| IUPAC Name | [3-[6-(3-methylphenyl)-2-pyridinyl]piperidin-1-yl]-(4-phenyloxan-4-yl)methanone |
| SMILES | Cc1cccc(-c2cccc(C3CCCN(C(=O)C4(c5ccccc5)CCOCC4)C3)n2)c1 |
| InChI | InChI=1S/C29H32N2O2/c1-22-8-5-9-23(20-22)26-13-6-14-27(30-26)24-10-7-17-31(21-24)28(32)29(15-18-33-19-16-29)25-11-3-2-4-12-25/h2-6,8-9,11-14,20,24H,7,10,15-19,21H2,1H3 |
| InChIKey | UQVKKVRYZGOKMO-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.59 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |