C28H31N3O4 — CID 129459227
[4-(4-methoxyphenyl)oxan-4-yl]-[(3S)-3-(3-phenoxypyrazin-2-yl)piperidin-1-yl]methanone (PubChem CID 129459227) has the molecular formula C28H31N3O4 and a molecular weight of 473.57 g/mol. Its IUPAC name is [4-(4-methoxyphenyl)oxan-4-yl]-[(3S)-3-(3-phenoxypyrazin-2-yl)piperidin-1-yl]methanone.
| Compound Name | [4-(4-methoxyphenyl)oxan-4-yl]-[(3S)-3-(3-phenoxypyrazin-2-yl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 129459227 |
| Molecular Formula | C28H31N3O4 |
| Molecular Weight | 473.57 g/mol |
| Exact Mass | 473.23 |
| IUPAC Name | [4-(4-methoxyphenyl)oxan-4-yl]-[(3S)-3-(3-phenoxypyrazin-2-yl)piperidin-1-yl]methanone |
| SMILES | COc1ccc(C2(C(=O)N3CCC[C@H](c4nccnc4Oc4ccccc4)C3)CCOCC2)cc1 |
| InChI | InChI=1S/C28H31N3O4/c1-33-23-11-9-22(10-12-23)28(13-18-34-19-14-28)27(32)31-17-5-6-21(20-31)25-26(30-16-15-29-25)35-24-7-3-2-4-8-24/h2-4,7-12,15-16,21H,5-6,13-14,17-20H2,1H3/t21-/m0/s1 |
| InChIKey | WSSMGBBPDBIJBO-NRFANRHFSA-N |
| XLogP | 4.73 |
| TPSA | 73.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.57 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |