C27H28FN3O3 — CID 129454072
[(3S)-3-[3-(4-fluorophenoxy)pyrazin-2-yl]piperidin-1-yl]-(4-phenyloxan-4-yl)methanone (PubChem CID 129454072) has the molecular formula C27H28FN3O3 and a molecular weight of 461.54 g/mol. Its IUPAC name is [(3S)-3-[3-(4-fluorophenoxy)pyrazin-2-yl]piperidin-1-yl]-(4-phenyloxan-4-yl)methanone.
| Compound Name | [(3S)-3-[3-(4-fluorophenoxy)pyrazin-2-yl]piperidin-1-yl]-(4-phenyloxan-4-yl)methanone |
|---|---|
| PubChem CID | 129454072 |
| Molecular Formula | C27H28FN3O3 |
| Molecular Weight | 461.54 g/mol |
| Exact Mass | 461.21 |
| IUPAC Name | [(3S)-3-[3-(4-fluorophenoxy)pyrazin-2-yl]piperidin-1-yl]-(4-phenyloxan-4-yl)methanone |
| SMILES | O=C(N1CCC[C@H](c2nccnc2Oc2ccc(F)cc2)C1)C1(c2ccccc2)CCOCC1 |
| InChI | InChI=1S/C27H28FN3O3/c28-22-8-10-23(11-9-22)34-25-24(29-14-15-30-25)20-5-4-16-31(19-20)26(32)27(12-17-33-18-13-27)21-6-2-1-3-7-21/h1-3,6-11,14-15,20H,4-5,12-13,16-19H2/t20-/m0/s1 |
| InChIKey | CSETYBDHOOVGOO-FQEVSTJZSA-N |
| XLogP | 4.86 |
| TPSA | 64.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.54 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |