C21H24FN3O3 — CID 95823091
[(3R)-3-[3-(2-fluorophenoxy)pyrazin-2-yl]piperidin-1-yl]-(oxan-4-yl)methanone (PubChem CID 95823091) has the molecular formula C21H24FN3O3 and a molecular weight of 385.44 g/mol. Its IUPAC name is [(3R)-3-[3-(2-fluorophenoxy)pyrazin-2-yl]piperidin-1-yl]-(oxan-4-yl)methanone.
| Compound Name | [(3R)-3-[3-(2-fluorophenoxy)pyrazin-2-yl]piperidin-1-yl]-(oxan-4-yl)methanone |
|---|---|
| PubChem CID | 95823091 |
| Molecular Formula | C21H24FN3O3 |
| Molecular Weight | 385.44 g/mol |
| Exact Mass | 385.18 |
| IUPAC Name | [(3R)-3-[3-(2-fluorophenoxy)pyrazin-2-yl]piperidin-1-yl]-(oxan-4-yl)methanone |
| SMILES | O=C(C1CCOCC1)N1CCC[C@@H](c2nccnc2Oc2ccccc2F)C1 |
| InChI | InChI=1S/C21H24FN3O3/c22-17-5-1-2-6-18(17)28-20-19(23-9-10-24-20)16-4-3-11-25(14-16)21(26)15-7-12-27-13-8-15/h1-2,5-6,9-10,15-16H,3-4,7-8,11-14H2/t16-/m1/s1 |
| InChIKey | GIIJAEKNOYXTMT-MRXNPFEDSA-N |
| XLogP | 3.54 |
| TPSA | 64.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.44 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |