C20H22FN3O2 — CID 95822243
cyclopropyl-[(3R)-3-[4-(2-fluorophenoxy)-6-methylpyrimidin-2-yl]piperidin-1-yl]methanone (PubChem CID 95822243) has the molecular formula C20H22FN3O2 and a molecular weight of 355.41 g/mol. Its IUPAC name is cyclopropyl-[(3R)-3-[4-(2-fluorophenoxy)-6-methylpyrimidin-2-yl]piperidin-1-yl]methanone.
| Compound Name | cyclopropyl-[(3R)-3-[4-(2-fluorophenoxy)-6-methylpyrimidin-2-yl]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 95822243 |
| Molecular Formula | C20H22FN3O2 |
| Molecular Weight | 355.41 g/mol |
| Exact Mass | 355.17 |
| IUPAC Name | cyclopropyl-[(3R)-3-[4-(2-fluorophenoxy)-6-methylpyrimidin-2-yl]piperidin-1-yl]methanone |
| SMILES | Cc1cc(Oc2ccccc2F)nc([C@@H]2CCCN(C(=O)C3CC3)C2)n1 |
| InChI | InChI=1S/C20H22FN3O2/c1-13-11-18(26-17-7-3-2-6-16(17)21)23-19(22-13)15-5-4-10-24(12-15)20(25)14-8-9-14/h2-3,6-7,11,14-15H,4-5,8-10,12H2,1H3/t15-/m1/s1 |
| InChIKey | WZHPNFMQXYOGFB-OAHLLOKOSA-N |
| XLogP | 3.83 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.41 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |