C21H25N3O3 — CID 95822246
cyclopropyl-[(3S)-3-[4-(4-methoxyphenoxy)-6-methylpyrimidin-2-yl]piperidin-1-yl]methanone (PubChem CID 95822246) has the molecular formula C21H25N3O3 and a molecular weight of 367.45 g/mol. Its IUPAC name is cyclopropyl-[(3S)-3-[4-(4-methoxyphenoxy)-6-methylpyrimidin-2-yl]piperidin-1-yl]methanone.
| Compound Name | cyclopropyl-[(3S)-3-[4-(4-methoxyphenoxy)-6-methylpyrimidin-2-yl]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 95822246 |
| Molecular Formula | C21H25N3O3 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.19 |
| IUPAC Name | cyclopropyl-[(3S)-3-[4-(4-methoxyphenoxy)-6-methylpyrimidin-2-yl]piperidin-1-yl]methanone |
| SMILES | COc1ccc(Oc2cc(C)nc([C@H]3CCCN(C(=O)C4CC4)C3)n2)cc1 |
| InChI | InChI=1S/C21H25N3O3/c1-14-12-19(27-18-9-7-17(26-2)8-10-18)23-20(22-14)16-4-3-11-24(13-16)21(25)15-5-6-15/h7-10,12,15-16H,3-6,11,13H2,1-2H3/t16-/m0/s1 |
| InChIKey | AUFMSHCHMURUBD-INIZCTEOSA-N |
| XLogP | 3.70 |
| TPSA | 64.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |