C19H23N3O3 — CID 95843343
1-[(2S)-2-[4-(4-methoxyphenoxy)-6-methylpyrimidin-2-yl]piperidin-1-yl]ethanone (PubChem CID 95843343) has the molecular formula C19H23N3O3 and a molecular weight of 341.41 g/mol. Its IUPAC name is 1-[(2S)-2-[4-(4-methoxyphenoxy)-6-methylpyrimidin-2-yl]piperidin-1-yl]ethanone.
| Compound Name | 1-[(2S)-2-[4-(4-methoxyphenoxy)-6-methylpyrimidin-2-yl]piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 95843343 |
| Molecular Formula | C19H23N3O3 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.17 |
| IUPAC Name | 1-[(2S)-2-[4-(4-methoxyphenoxy)-6-methylpyrimidin-2-yl]piperidin-1-yl]ethanone |
| SMILES | COc1ccc(Oc2cc(C)nc([C@@H]3CCCCN3C(C)=O)n2)cc1 |
| InChI | InChI=1S/C19H23N3O3/c1-13-12-18(25-16-9-7-15(24-3)8-10-16)21-19(20-13)17-6-4-5-11-22(17)14(2)23/h7-10,12,17H,4-6,11H2,1-3H3/t17-/m0/s1 |
| InChIKey | KBNBWOKXKPRMKZ-KRWDZBQOSA-N |
| XLogP | 3.66 |
| TPSA | 64.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |