C12H14F3N3O — CID 127244749
1-[2-[4-methyl-6-(trifluoromethyl)pyrimidin-2-yl]pyrrolidin-1-yl]ethanone (PubChem CID 127244749) has the molecular formula C12H14F3N3O and a molecular weight of 273.26 g/mol. Its IUPAC name is 1-[2-[4-methyl-6-(trifluoromethyl)pyrimidin-2-yl]pyrrolidin-1-yl]ethanone.
| Compound Name | 1-[2-[4-methyl-6-(trifluoromethyl)pyrimidin-2-yl]pyrrolidin-1-yl]ethanone |
|---|---|
| PubChem CID | 127244749 |
| Molecular Formula | C12H14F3N3O |
| Molecular Weight | 273.26 g/mol |
| Exact Mass | 273.11 |
| IUPAC Name | 1-[2-[4-methyl-6-(trifluoromethyl)pyrimidin-2-yl]pyrrolidin-1-yl]ethanone |
| SMILES | CC(=O)N1CCCC1c1nc(C)cc(C(F)(F)F)n1 |
| InChI | InChI=1S/C12H14F3N3O/c1-7-6-10(12(13,14)15)17-11(16-7)9-4-3-5-18(9)8(2)19/h6,9H,3-5H2,1-2H3 |
| InChIKey | KMFXTMCQAXFPPQ-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.26 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |