C22H27FN4O2 — CID 110256734
[3-[3-(3-fluorophenoxy)pyrazin-2-yl]piperidin-1-yl]-(1-methylpiperidin-4-yl)methanone (PubChem CID 110256734) has the molecular formula C22H27FN4O2 and a molecular weight of 398.48 g/mol. Its IUPAC name is [3-[3-(3-fluorophenoxy)pyrazin-2-yl]piperidin-1-yl]-(1-methylpiperidin-4-yl)methanone.
| Compound Name | [3-[3-(3-fluorophenoxy)pyrazin-2-yl]piperidin-1-yl]-(1-methylpiperidin-4-yl)methanone |
|---|---|
| PubChem CID | 110256734 |
| Molecular Formula | C22H27FN4O2 |
| Molecular Weight | 398.48 g/mol |
| Exact Mass | 398.21 |
| IUPAC Name | [3-[3-(3-fluorophenoxy)pyrazin-2-yl]piperidin-1-yl]-(1-methylpiperidin-4-yl)methanone |
| SMILES | CN1CCC(C(=O)N2CCCC(c3nccnc3Oc3cccc(F)c3)C2)CC1 |
| InChI | InChI=1S/C22H27FN4O2/c1-26-12-7-16(8-13-26)22(28)27-11-3-4-17(15-27)20-21(25-10-9-24-20)29-19-6-2-5-18(23)14-19/h2,5-6,9-10,14,16-17H,3-4,7-8,11-13,15H2,1H3 |
| InChIKey | DAEOBYIQNBBZCZ-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.48 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |