C20H18FN5O2 — CID 95822353
[(3R)-3-[3-(3-fluorophenoxy)pyrazin-2-yl]piperidin-1-yl]-pyrazin-2-ylmethanone (PubChem CID 95822353) has the molecular formula C20H18FN5O2 and a molecular weight of 379.40 g/mol. Its IUPAC name is [(3R)-3-[3-(3-fluorophenoxy)pyrazin-2-yl]piperidin-1-yl]-pyrazin-2-ylmethanone.
| Compound Name | [(3R)-3-[3-(3-fluorophenoxy)pyrazin-2-yl]piperidin-1-yl]-pyrazin-2-ylmethanone |
|---|---|
| PubChem CID | 95822353 |
| Molecular Formula | C20H18FN5O2 |
| Molecular Weight | 379.40 g/mol |
| Exact Mass | 379.14 |
| IUPAC Name | [(3R)-3-[3-(3-fluorophenoxy)pyrazin-2-yl]piperidin-1-yl]-pyrazin-2-ylmethanone |
| SMILES | O=C(c1cnccn1)N1CCC[C@@H](c2nccnc2Oc2cccc(F)c2)C1 |
| InChI | InChI=1S/C20H18FN5O2/c21-15-4-1-5-16(11-15)28-19-18(24-8-9-25-19)14-3-2-10-26(13-14)20(27)17-12-22-6-7-23-17/h1,4-9,11-12,14H,2-3,10,13H2/t14-/m1/s1 |
| InChIKey | WXXLALJZYFPRQI-CQSZACIVSA-N |
| XLogP | 3.22 |
| TPSA | 81.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.40 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |