C25H27N5O3 — CID 110151084
(2-morpholin-4-yl-4-pyridinyl)-[3-(3-phenoxypyrazin-2-yl)piperidin-1-yl]methanone (PubChem CID 110151084) has the molecular formula C25H27N5O3 and a molecular weight of 445.52 g/mol. Its IUPAC name is (2-morpholin-4-yl-4-pyridinyl)-[3-(3-phenoxypyrazin-2-yl)piperidin-1-yl]methanone.
| Compound Name | (2-morpholin-4-yl-4-pyridinyl)-[3-(3-phenoxypyrazin-2-yl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 110151084 |
| Molecular Formula | C25H27N5O3 |
| Molecular Weight | 445.52 g/mol |
| Exact Mass | 445.21 |
| IUPAC Name | (2-morpholin-4-yl-4-pyridinyl)-[3-(3-phenoxypyrazin-2-yl)piperidin-1-yl]methanone |
| SMILES | O=C(c1ccnc(N2CCOCC2)c1)N1CCCC(c2nccnc2Oc2ccccc2)C1 |
| InChI | InChI=1S/C25H27N5O3/c31-25(19-8-9-26-22(17-19)29-13-15-32-16-14-29)30-12-4-5-20(18-30)23-24(28-11-10-27-23)33-21-6-2-1-3-7-21/h1-3,6-11,17,20H,4-5,12-16,18H2 |
| InChIKey | ZHBFCDHHTAOQNZ-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 80.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.52 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |