C28H30N2O5 — CID 124961302
[(2S)-2-[6-(4-methoxyphenoxy)-2-pyridinyl]morpholin-4-yl]-(4-phenyloxan-4-yl)methanone (PubChem CID 124961302) has the molecular formula C28H30N2O5 and a molecular weight of 474.56 g/mol. Its IUPAC name is [(2S)-2-[6-(4-methoxyphenoxy)-2-pyridinyl]morpholin-4-yl]-(4-phenyloxan-4-yl)methanone.
| Compound Name | [(2S)-2-[6-(4-methoxyphenoxy)-2-pyridinyl]morpholin-4-yl]-(4-phenyloxan-4-yl)methanone |
|---|---|
| PubChem CID | 124961302 |
| Molecular Formula | C28H30N2O5 |
| Molecular Weight | 474.56 g/mol |
| Exact Mass | 474.22 |
| IUPAC Name | [(2S)-2-[6-(4-methoxyphenoxy)-2-pyridinyl]morpholin-4-yl]-(4-phenyloxan-4-yl)methanone |
| SMILES | COc1ccc(Oc2cccc([C@@H]3CN(C(=O)C4(c5ccccc5)CCOCC4)CCO3)n2)cc1 |
| InChI | InChI=1S/C28H30N2O5/c1-32-22-10-12-23(13-11-22)35-26-9-5-8-24(29-26)25-20-30(16-19-34-25)27(31)28(14-17-33-18-15-28)21-6-3-2-4-7-21/h2-13,25H,14-20H2,1H3/t25-/m0/s1 |
| InChIKey | HAOZABHBUIGKQT-VWLOTQADSA-N |
| XLogP | 4.53 |
| TPSA | 70.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.56 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |