C28H35NO3 — CID 110149302
[(3aR,4R,7aS)-4-[(4-methoxyphenyl)methyl]-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(4-phenyloxan-4-yl)methanone (PubChem CID 110149302) has the molecular formula C28H35NO3 and a molecular weight of 433.59 g/mol. Its IUPAC name is [(3aR,4R,7aS)-4-[(4-methoxyphenyl)methyl]-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(4-phenyloxan-4-yl)methanone.
| Compound Name | [(3aR,4R,7aS)-4-[(4-methoxyphenyl)methyl]-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(4-phenyloxan-4-yl)methanone |
|---|---|
| PubChem CID | 110149302 |
| Molecular Formula | C28H35NO3 |
| Molecular Weight | 433.59 g/mol |
| Exact Mass | 433.26 |
| IUPAC Name | [(3aR,4R,7aS)-4-[(4-methoxyphenyl)methyl]-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(4-phenyloxan-4-yl)methanone |
| SMILES | COc1ccc(C[C@H]2CCC[C@@H]3CN(C(=O)C4(c5ccccc5)CCOCC4)C[C@H]23)cc1 |
| InChI | InChI=1S/C28H35NO3/c1-31-25-12-10-21(11-13-25)18-22-6-5-7-23-19-29(20-26(22)23)27(30)28(14-16-32-17-15-28)24-8-3-2-4-9-24/h2-4,8-13,22-23,26H,5-7,14-20H2,1H3/t22-,23-,26-/m1/s1 |
| InChIKey | QGEQFGVCPBVYJA-JQYIIUTOSA-N |
| XLogP | 4.86 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.59 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |