C26H30FNO2 — CID 110138743
[(3aR,4R,6aS)-4-[(3-fluorophenyl)methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-(4-phenyloxan-4-yl)methanone (PubChem CID 110138743) has the molecular formula C26H30FNO2 and a molecular weight of 407.53 g/mol. Its IUPAC name is [(3aR,4R,6aS)-4-[(3-fluorophenyl)methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-(4-phenyloxan-4-yl)methanone.
| Compound Name | [(3aR,4R,6aS)-4-[(3-fluorophenyl)methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-(4-phenyloxan-4-yl)methanone |
|---|---|
| PubChem CID | 110138743 |
| Molecular Formula | C26H30FNO2 |
| Molecular Weight | 407.53 g/mol |
| Exact Mass | 407.23 |
| IUPAC Name | [(3aR,4R,6aS)-4-[(3-fluorophenyl)methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-(4-phenyloxan-4-yl)methanone |
| SMILES | O=C(N1C[C@H]2CC[C@H](Cc3cccc(F)c3)[C@H]2C1)C1(c2ccccc2)CCOCC1 |
| InChI | InChI=1S/C26H30FNO2/c27-23-8-4-5-19(16-23)15-20-9-10-21-17-28(18-24(20)21)25(29)26(11-13-30-14-12-26)22-6-2-1-3-7-22/h1-8,16,20-21,24H,9-15,17-18H2/t20-,21-,24-/m1/s1 |
| InChIKey | BEJQLSVKGAWYTL-PQNGQFLHSA-N |
| XLogP | 4.60 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.53 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |