C16H20FNO2 — CID 110096901
1-[(3aR,4R,6aS)-4-[(3-fluorophenyl)methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-2-hydroxyethanone (PubChem CID 110096901) has the molecular formula C16H20FNO2 and a molecular weight of 277.34 g/mol. Its IUPAC name is 1-[(3aR,4R,6aS)-4-[(3-fluorophenyl)methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-2-hydroxyethanone.
| Compound Name | 1-[(3aR,4R,6aS)-4-[(3-fluorophenyl)methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-2-hydroxyethanone |
|---|---|
| PubChem CID | 110096901 |
| Molecular Formula | C16H20FNO2 |
| Molecular Weight | 277.34 g/mol |
| Exact Mass | 277.15 |
| IUPAC Name | 1-[(3aR,4R,6aS)-4-[(3-fluorophenyl)methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-2-hydroxyethanone |
| SMILES | O=C(CO)N1C[C@H]2CC[C@H](Cc3cccc(F)c3)[C@H]2C1 |
| InChI | InChI=1S/C16H20FNO2/c17-14-3-1-2-11(7-14)6-12-4-5-13-8-18(9-15(12)13)16(20)10-19/h1-3,7,12-13,15,19H,4-6,8-10H2/t12-,13-,15-/m1/s1 |
| InChIKey | GAIDACPZPGSZIW-UMVBOHGHSA-N |
| XLogP | 1.85 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.34 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |