C14H16FNO2 — CID 97377913
1-[(3aR,6aR)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]pyrrol-5-yl]-2-(3-fluorophenyl)ethanone (PubChem CID 97377913) has the molecular formula C14H16FNO2 and a molecular weight of 249.28 g/mol. Its IUPAC name is 1-[(3aR,6aR)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]pyrrol-5-yl]-2-(3-fluorophenyl)ethanone.
| Compound Name | 1-[(3aR,6aR)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]pyrrol-5-yl]-2-(3-fluorophenyl)ethanone |
|---|---|
| PubChem CID | 97377913 |
| Molecular Formula | C14H16FNO2 |
| Molecular Weight | 249.28 g/mol |
| Exact Mass | 249.12 |
| IUPAC Name | 1-[(3aR,6aR)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]pyrrol-5-yl]-2-(3-fluorophenyl)ethanone |
| SMILES | O=C(Cc1cccc(F)c1)N1C[C@@H]2COC[C@H]2C1 |
| InChI | InChI=1S/C14H16FNO2/c15-13-3-1-2-10(4-13)5-14(17)16-6-11-8-18-9-12(11)7-16/h1-4,11-12H,5-9H2/t11-,12-/m1/s1 |
| InChIKey | PDBRZABNOMGOOJ-VXGBXAGGSA-N |
| XLogP | 1.47 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.28 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |