C18H27FN2O2 — CID 110662541
2-(3-fluorophenyl)-1-[4-(3-methoxypropyl)-3,5-dimethylpiperazin-1-yl]ethanone (PubChem CID 110662541) has the molecular formula C18H27FN2O2 and a molecular weight of 322.42 g/mol. Its IUPAC name is 2-(3-fluorophenyl)-1-[4-(3-methoxypropyl)-3,5-dimethylpiperazin-1-yl]ethanone.
| Compound Name | 2-(3-fluorophenyl)-1-[4-(3-methoxypropyl)-3,5-dimethylpiperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 110662541 |
| Molecular Formula | C18H27FN2O2 |
| Molecular Weight | 322.42 g/mol |
| Exact Mass | 322.21 |
| IUPAC Name | 2-(3-fluorophenyl)-1-[4-(3-methoxypropyl)-3,5-dimethylpiperazin-1-yl]ethanone |
| SMILES | COCCCN1C(C)CN(C(=O)Cc2cccc(F)c2)CC1C |
| InChI | InChI=1S/C18H27FN2O2/c1-14-12-20(13-15(2)21(14)8-5-9-23-3)18(22)11-16-6-4-7-17(19)10-16/h4,6-7,10,14-15H,5,8-9,11-13H2,1-3H3 |
| InChIKey | WSQHWDUHGDJUIE-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.42 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|